C22H38N2O6 — CID 70068754
(2R)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]nonanoic acid (PubChem CID 70068754) has the molecular formula C22H38N2O6 and a molecular weight of 426.55 g/mol. Its IUPAC name is (2R)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]nonanoic acid.
| Compound Name | (2R)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]nonanoic acid |
|---|---|
| PubChem CID | 70068754 |
| Molecular Formula | C22H38N2O6 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | (2R)-2-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-3-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)propan-2-yl]nonanoic acid |
| SMILES | CCCCCCC[C@@H](C(=O)O)C(CN1C(=O)N(C)C(C)(C)C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H38N2O6/c1-8-9-10-11-12-13-15(17(25)26)16(18(27)30-21(2,3)4)14-24-19(28)22(5,6)23(7)20(24)29/h15-16H,8-14H2,1-7H3,(H,25,26)/t15-,16?/m1/s1 |
| InChIKey | IZMDBOKGOIWEFV-AAFJCEBUSA-N |
| XLogP | 3.68 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|