C16H27BrN2O4 — CID 142682605
butyl 2-(bromomethyl)-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoate (PubChem CID 142682605) has the molecular formula C16H27BrN2O4 and a molecular weight of 391.31 g/mol. Its IUPAC name is butyl 2-(bromomethyl)-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoate.
| Compound Name | butyl 2-(bromomethyl)-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoate |
|---|---|
| PubChem CID | 142682605 |
| Molecular Formula | C16H27BrN2O4 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | butyl 2-(bromomethyl)-5-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)pentanoate |
| SMILES | CCCCOC(=O)C(CBr)CCCN1C(=O)N(C)C(C)(C)C1=O |
| InChI | InChI=1S/C16H27BrN2O4/c1-5-6-10-23-13(20)12(11-17)8-7-9-19-14(21)16(2,3)18(4)15(19)22/h12H,5-11H2,1-4H3 |
| InChIKey | UMIHRXKVIWLPPM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|