About 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate
2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate (PubChem CID 70070367) has the molecular formula C21H19NO4
and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate.
Molecular Properties
| Compound Name | 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate |
| PubChem CID | 70070367 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate |
| SMILES | CC(=O)/C(=C/c1ccccc1C#N)C(=O)OCCOCc1ccccc1 |
| InChI | InChI=1S/C21H19NO4/c1-16(23)20(13-18-9-5-6-10-19(18)14-22)21(24)26-12-11-25-15-17-7-3-2-4-8-17/h2-10,13H,11-12,15H2,1H3/b20-13- |
| InChIKey | BWUSYDKPSJGBPN-MOSHPQCFSA-N |
| XLogP | 3.29 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate?
The IUPAC name of 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate (CID 70070367) is 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate.
What is the SMILES notation for 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate?
The canonical SMILES for 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate is CC(=O)/C(=C/c1ccccc1C#N)C(=O)OCCOCc1ccccc1.
What is the InChIKey of 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate?
The InChIKey is BWUSYDKPSJGBPN-MOSHPQCFSA-N. The full InChI is InChI=1S/C21H19NO4/c1-16(23)20(13-18-9-5-6-10-19(18)14-22)21(24)26-12-11-25-15-17-7-3-2-4-8-17/h2-10,13H,11-12,15H2,1H3/b20-13-.
What are the key properties of 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate?
2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate has a molecular weight of 349.39 g/mol, XLogP of 3.29, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxyethyl (2Z)-2-[(2-cyanophenyl)methylidene]-3-oxobutanoate is sourced from PubChem (CID 70070367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).