C28H38O2 — CID 70071311
(8R,9R,10S,13S,14S)-17-methoxy-10,13-dimethyl-3-(2-phenylethynyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 70071311) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-17-methoxy-10,13-dimethyl-3-(2-phenylethynyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9R,10S,13S,14S)-17-methoxy-10,13-dimethyl-3-(2-phenylethynyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 70071311 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (8R,9R,10S,13S,14S)-17-methoxy-10,13-dimethyl-3-(2-phenylethynyl)-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | COC1(O)CC[C@H]2[C@@H]3CCC4CC(C#Cc5ccccc5)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H38O2/c1-26-16-13-21(10-9-20-7-5-4-6-8-20)19-22(26)11-12-23-24(26)14-17-27(2)25(23)15-18-28(27,29)30-3/h4-8,21-25,29H,11-19H2,1-3H3/t21?,22?,23-,24-,25+,26+,27+,28?/m1/s1 |
| InChIKey | GGZWUGBBTVWAFW-KWENSDEDSA-N |
| XLogP | 6.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|