C28H41FO — CID 129162666
1-[(5S)-17-benzyl-3-fluoro-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol (PubChem CID 129162666) has the molecular formula C28H41FO and a molecular weight of 412.63 g/mol. Its IUPAC name is 1-[(5S)-17-benzyl-3-fluoro-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol.
| Compound Name | 1-[(5S)-17-benzyl-3-fluoro-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
|---|---|
| PubChem CID | 129162666 |
| Molecular Formula | C28H41FO |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 1-[(5S)-17-benzyl-3-fluoro-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
| SMILES | CC(O)C1(Cc2ccccc2)CCC2C3CC[C@H]4CC(F)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C28H41FO/c1-19(30)28(18-20-7-5-4-6-8-20)16-13-25-23-10-9-21-17-22(29)11-14-26(21,2)24(23)12-15-27(25,28)3/h4-8,19,21-25,30H,9-18H2,1-3H3/t19?,21-,22?,23?,24?,25?,26?,27?,28?/m0/s1 |
| InChIKey | KUQMSNNIAQSIKV-PBIURNHBSA-N |
| XLogP | 6.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |