C27H38O2 — CID 88760950
(1R,2S,11R,12S,16S)-4-benzyl-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol (PubChem CID 88760950) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is (1R,2S,11R,12S,16S)-4-benzyl-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol.
| Compound Name | (1R,2S,11R,12S,16S)-4-benzyl-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol |
|---|---|
| PubChem CID | 88760950 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | (1R,2S,11R,12S,16S)-4-benzyl-2,15,16-trimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-15-ol |
| SMILES | CC1(O)CC[C@H]2[C@@H]3CCC4CC5OC5(Cc5ccccc5)C[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H38O2/c1-24-17-27(16-18-7-5-4-6-8-18)23(29-27)15-19(24)9-10-20-21(24)11-13-25(2)22(20)12-14-26(25,3)28/h4-8,19-23,28H,9-17H2,1-3H3/t19?,20-,21-,22+,23?,24+,25+,26?,27?/m1/s1 |
| InChIKey | MMKCNJMFBQBXLX-XDCXHBIVSA-N |
| XLogP | 5.77 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|