C26H34O3 — CID 90720449
(8R,9R,10R,13S,14S)-17-benzyl-17-hydroxy-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,4-dione (PubChem CID 90720449) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-benzyl-17-hydroxy-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,4-dione.
| Compound Name | (8R,9R,10R,13S,14S)-17-benzyl-17-hydroxy-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,4-dione |
|---|---|
| PubChem CID | 90720449 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-benzyl-17-hydroxy-10,13-dimethyl-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,4-dione |
| SMILES | C[C@]12CCC(=O)C(=O)C1CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)Cc1ccccc1 |
| InChI | InChI=1S/C26H34O3/c1-24-13-12-22(27)23(28)21(24)9-8-18-19(24)10-14-25(2)20(18)11-15-26(25,29)16-17-6-4-3-5-7-17/h3-7,18-21,29H,8-16H2,1-2H3/t18-,19-,20+,21?,24-,25+,26?/m1/s1 |
| InChIKey | NZRHVSCVLKOHCV-WQXJRPDSSA-N |
| XLogP | 4.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|