C26H33NO3 — CID 118730069
(2Z,8R,9S,10R,13S,14S,17R)-17-hydroxy-2-(hydroxymethylidene)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 118730069) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is (2Z,8R,9S,10R,13S,14S,17R)-17-hydroxy-2-(hydroxymethylidene)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (2Z,8R,9S,10R,13S,14S,17R)-17-hydroxy-2-(hydroxymethylidene)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 118730069 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (2Z,8R,9S,10R,13S,14S,17R)-17-hydroxy-2-(hydroxymethylidene)-10,13-dimethyl-17-(pyridin-2-ylmethyl)-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C/C(=C/O)C(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)Cc1ccccn1 |
| InChI | InChI=1S/C26H33NO3/c1-24-14-17(16-28)23(29)13-18(24)6-7-20-21(24)8-10-25(2)22(20)9-11-26(25,30)15-19-5-3-4-12-27-19/h3-5,12-13,16,20-22,28,30H,6-11,14-15H2,1-2H3/b17-16-/t20-,21+,22+,24+,25+,26-/m1/s1 |
| InChIKey | PPTWJDLEKRSAMQ-CPCNJFITSA-N |
| XLogP | 4.94 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|