C24H34O2 — CID 91350932
2-(2,2-dimethylpropylidene)-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 91350932) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylidene)-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 2-(2,2-dimethylpropylidene)-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 91350932 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-(2,2-dimethylpropylidene)-10,13-dimethyl-1,6,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC(C)(C)C=C1CC2(C)C(=CC1=O)CCC1C3CCC(=O)C3(C)CCC12 |
| InChI | InChI=1S/C24H34O2/c1-22(2,3)13-15-14-24(5)16(12-20(15)25)6-7-17-18-8-9-21(26)23(18,4)11-10-19(17)24/h12-13,17-19H,6-11,14H2,1-5H3 |
| InChIKey | QJTJPHYWLWFQHU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|