C18H21BrClN3O2 — CID 70073342
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-(5-bromo-1-methylindol-3-yl)-2-oxoacetamide;hydrochloride (PubChem CID 70073342) has the molecular formula C18H21BrClN3O2 and a molecular weight of 426.74 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-(5-bromo-1-methylindol-3-yl)-2-oxoacetamide;hydrochloride.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-(5-bromo-1-methylindol-3-yl)-2-oxoacetamide;hydrochloride |
|---|---|
| PubChem CID | 70073342 |
| Molecular Formula | C18H21BrClN3O2 |
| Molecular Weight | 426.74 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-(5-bromo-1-methylindol-3-yl)-2-oxoacetamide;hydrochloride |
| SMILES | Cl.Cn1cc(C(=O)C(=O)N[C@@H]2CN3CCC2CC3)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H20BrN3O2.ClH/c1-21-9-14(13-8-12(19)2-3-16(13)21)17(23)18(24)20-15-10-22-6-4-11(15)5-7-22;/h2-3,8-9,11,15H,4-7,10H2,1H3,(H,20,24);1H/t15-;/m1./s1 |
| InChIKey | NGBLXJROEGCTNP-XFULWGLBSA-N |
| XLogP | 2.76 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.74 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|