C21H26ClN3O2 — CID 70074579
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-[1-(cyclopropylmethyl)indol-3-yl]-2-oxoacetamide;hydrochloride (PubChem CID 70074579) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-[1-(cyclopropylmethyl)indol-3-yl]-2-oxoacetamide;hydrochloride.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-[1-(cyclopropylmethyl)indol-3-yl]-2-oxoacetamide;hydrochloride |
|---|---|
| PubChem CID | 70074579 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-2-[1-(cyclopropylmethyl)indol-3-yl]-2-oxoacetamide;hydrochloride |
| SMILES | Cl.O=C(N[C@@H]1CN2CCC1CC2)C(=O)c1cn(CC2CC2)c2ccccc12 |
| InChI | InChI=1S/C21H25N3O2.ClH/c25-20(21(26)22-18-13-23-9-7-15(18)8-10-23)17-12-24(11-14-5-6-14)19-4-2-1-3-16(17)19;/h1-4,12,14-15,18H,5-11,13H2,(H,22,26);1H/t18-;/m1./s1 |
| InChIKey | SCZDRVVDJPGEAQ-GMUIIQOCSA-N |
| XLogP | 2.87 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|