C19H24N4O6 — CID 70073674
2-[[2-carboxy-2-[3-[(2-nitrophenyl)methyl]imidazol-4-yl]ethyl]amino]-4-methylpentanoic acid (PubChem CID 70073674) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[[2-carboxy-2-[3-[(2-nitrophenyl)methyl]imidazol-4-yl]ethyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-carboxy-2-[3-[(2-nitrophenyl)methyl]imidazol-4-yl]ethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70073674 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[[2-carboxy-2-[3-[(2-nitrophenyl)methyl]imidazol-4-yl]ethyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NCC(C(=O)O)c1cncn1Cc1ccccc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C19H24N4O6/c1-12(2)7-15(19(26)27)21-8-14(18(24)25)17-9-20-11-22(17)10-13-5-3-4-6-16(13)23(28)29/h3-6,9,11-12,14-15,21H,7-8,10H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | XXCPQVDZVGPWJY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|