C34H53N5O5 — CID 70075656
(2R)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-(dimethylamino)-2-oxoethyl]-2-(1H-imidazol-5-ylmethyl)-N'-[(1S)-1-phenylethyl]butanediamide (PubChem CID 70075656) has the molecular formula C34H53N5O5 and a molecular weight of 611.83 g/mol. Its IUPAC name is (2R)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-(dimethylamino)-2-oxoethyl]-2-(1H-imidazol-5-ylmethyl)-N'-[(1S)-1-phenylethyl]butanediamide.
| Compound Name | (2R)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-(dimethylamino)-2-oxoethyl]-2-(1H-imidazol-5-ylmethyl)-N'-[(1S)-1-phenylethyl]butanediamide |
|---|---|
| PubChem CID | 70075656 |
| Molecular Formula | C34H53N5O5 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.40 |
| IUPAC Name | (2R)-N-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-(dimethylamino)-2-oxoethyl]-2-(1H-imidazol-5-ylmethyl)-N'-[(1S)-1-phenylethyl]butanediamide |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)N(CC(=O)N(C)C)C(=O)[C@@H](CC(=O)N[C@@H](C)c1ccccc1)Cc1cnc[nH]1 |
| InChI | InChI=1S/C34H53N5O5/c1-23(2)16-30(40)33(43)29(17-25-12-8-6-9-13-25)39(21-32(42)38(4)5)34(44)27(18-28-20-35-22-36-28)19-31(41)37-24(3)26-14-10-7-11-15-26/h7,10-11,14-15,20,22-25,27,29-30,33,40,43H,6,8-9,12-13,16-19,21H2,1-5H3,(H,35,36)(H,37,41)/t24-,27+,29-,30-,33+/m0/s1 |
| InChIKey | NSOSMDPKBLPHPX-SWOFUSQASA-N |
| XLogP | 3.86 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |