C31H34ClNO — CID 70076896
4-benzhydryl-1-[[3-methyl-5-(4-methylphenyl)furan-2-yl]methyl]piperidine;hydrochloride (PubChem CID 70076896) has the molecular formula C31H34ClNO and a molecular weight of 472.07 g/mol. Its IUPAC name is 4-benzhydryl-1-[[3-methyl-5-(4-methylphenyl)furan-2-yl]methyl]piperidine;hydrochloride.
| Compound Name | 4-benzhydryl-1-[[3-methyl-5-(4-methylphenyl)furan-2-yl]methyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 70076896 |
| Molecular Formula | C31H34ClNO |
| Molecular Weight | 472.07 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-benzhydryl-1-[[3-methyl-5-(4-methylphenyl)furan-2-yl]methyl]piperidine;hydrochloride |
| SMILES | Cc1ccc(-c2cc(C)c(CN3CCC(C(c4ccccc4)c4ccccc4)CC3)o2)cc1.Cl |
| InChI | InChI=1S/C31H33NO.ClH/c1-23-13-15-25(16-14-23)29-21-24(2)30(33-29)22-32-19-17-28(18-20-32)31(26-9-5-3-6-10-26)27-11-7-4-8-12-27;/h3-16,21,28,31H,17-20,22H2,1-2H3;1H |
| InChIKey | NYWYOZOUQOCQAV-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.07 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |