C26H27FN2O2 — CID 23435913
[4-[(1-benzylpiperidin-4-yl)-(3-fluorophenyl)methyl]phenyl]carbamic acid (PubChem CID 23435913) has the molecular formula C26H27FN2O2 and a molecular weight of 418.51 g/mol. Its IUPAC name is [4-[(1-benzylpiperidin-4-yl)-(3-fluorophenyl)methyl]phenyl]carbamic acid.
| Compound Name | [4-[(1-benzylpiperidin-4-yl)-(3-fluorophenyl)methyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 23435913 |
| Molecular Formula | C26H27FN2O2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [4-[(1-benzylpiperidin-4-yl)-(3-fluorophenyl)methyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(C(c2cccc(F)c2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H27FN2O2/c27-23-8-4-7-22(17-23)25(20-9-11-24(12-10-20)28-26(30)31)21-13-15-29(16-14-21)18-19-5-2-1-3-6-19/h1-12,17,21,25,28H,13-16,18H2,(H,30,31) |
| InChIKey | AFDDCBAPOAHFKO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |