C14H9ClFN3O4 — CID 70076958
[(7S)-13-chloro-14-fluoro-11-oxo-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-5-yl] hydrogen carbonate (PubChem CID 70076958) has the molecular formula C14H9ClFN3O4 and a molecular weight of 337.69 g/mol. Its IUPAC name is [(7S)-13-chloro-14-fluoro-11-oxo-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-5-yl] hydrogen carbonate.
| Compound Name | [(7S)-13-chloro-14-fluoro-11-oxo-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70076958 |
| Molecular Formula | C14H9ClFN3O4 |
| Molecular Weight | 337.69 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | [(7S)-13-chloro-14-fluoro-11-oxo-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-5-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ncn2c1[C@@H]1CCN1C(=O)c1c-2ccc(F)c1Cl |
| InChI | InChI=1S/C14H9ClFN3O4/c15-10-6(16)1-2-7-9(10)13(20)18-4-3-8(18)11-12(23-14(21)22)17-5-19(7)11/h1-2,5,8H,3-4H2,(H,21,22)/t8-/m0/s1 |
| InChIKey | ZZFZFXFNKUKNOJ-QMMMGPOBSA-N |
| XLogP | 2.62 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |