About (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate
(4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate (PubChem CID 70078914) has the molecular formula C23H20N4O3
and a molecular weight of 400.44 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate |
| PubChem CID | 70078914 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate |
| SMILES | CC(NC(=O)CCn1ccc2cc(C#N)ccc21)C(=O)OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H20N4O3/c1-16(23(29)30-15-18-4-2-17(13-24)3-5-18)26-22(28)9-11-27-10-8-20-12-19(14-25)6-7-21(20)27/h2-8,10,12,16H,9,11,15H2,1H3,(H,26,28) |
| InChIKey | HNECHWAWTHYNOK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate?
The IUPAC name of (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate (CID 70078914) is (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate.
What is the SMILES notation for (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate?
The canonical SMILES for (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate is CC(NC(=O)CCn1ccc2cc(C#N)ccc21)C(=O)OCc1ccc(C#N)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate?
The InChIKey is HNECHWAWTHYNOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4O3/c1-16(23(29)30-15-18-4-2-17(13-24)3-5-18)26-22(28)9-11-27-10-8-20-12-19(14-25)6-7-21(20)27/h2-8,10,12,16H,9,11,15H2,1H3,(H,26,28).
What are the key properties of (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate?
(4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate has a molecular weight of 400.44 g/mol, XLogP of 3.02, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 2-[3-(5-cyanoindol-1-yl)propanoylamino]propanoate is sourced from PubChem (CID 70078914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).