C17H21BrN2O3 — CID 45490726
(2S,3R)-2-[3-(5-bromoindol-1-yl)propanoylamino]-3-methylpentanoic acid (PubChem CID 45490726) has the molecular formula C17H21BrN2O3 and a molecular weight of 381.27 g/mol. Its IUPAC name is (2S,3R)-2-[3-(5-bromoindol-1-yl)propanoylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[3-(5-bromoindol-1-yl)propanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 45490726 |
| Molecular Formula | C17H21BrN2O3 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (2S,3R)-2-[3-(5-bromoindol-1-yl)propanoylamino]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CCn1ccc2cc(Br)ccc21)C(=O)O |
| InChI | InChI=1S/C17H21BrN2O3/c1-3-11(2)16(17(22)23)19-15(21)7-9-20-8-6-12-10-13(18)4-5-14(12)20/h4-6,8,10-11,16H,3,7,9H2,1-2H3,(H,19,21)(H,22,23)/t11-,16+/m1/s1 |
| InChIKey | WFUFRDLDHGCTPI-BZNIZROVSA-N |
| XLogP | 3.41 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |