C16H19BrN2O3 — CID 75117800
2-[[2-(6-bromoindol-1-yl)acetyl]amino]-3-methylpentanoic acid (PubChem CID 75117800) has the molecular formula C16H19BrN2O3 and a molecular weight of 367.24 g/mol. Its IUPAC name is 2-[[2-(6-bromoindol-1-yl)acetyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-(6-bromoindol-1-yl)acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 75117800 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[[2-(6-bromoindol-1-yl)acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)Cn1ccc2ccc(Br)cc21)C(=O)O |
| InChI | InChI=1S/C16H19BrN2O3/c1-3-10(2)15(16(21)22)18-14(20)9-19-7-6-11-4-5-12(17)8-13(11)19/h4-8,10,15H,3,9H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | STLFENREBKAMPD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |