C15H17BrN2O3 — CID 39310431
(2S)-2-[[2-(5-bromoindol-1-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 39310431) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is (2S)-2-[[2-(5-bromoindol-1-yl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-(5-bromoindol-1-yl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 39310431 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (2S)-2-[[2-(5-bromoindol-1-yl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)Cn1ccc2cc(Br)ccc21)C(=O)O |
| InChI | InChI=1S/C15H17BrN2O3/c1-9(2)14(15(20)21)17-13(19)8-18-6-5-10-7-11(16)3-4-12(10)18/h3-7,9,14H,8H2,1-2H3,(H,17,19)(H,20,21)/t14-/m0/s1 |
| InChIKey | LTNMIUMXDDLLJW-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |