C39H51N4O6P — CID 70079857
[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]-(4-phenylbutanoyl)amino]methyl-[4-[[(2S)-1-benzoylpyrrolidine-2-carbonyl]amino]butyl]phosphinic acid (PubChem CID 70079857) has the molecular formula C39H51N4O6P and a molecular weight of 702.83 g/mol. Its IUPAC name is [[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]-(4-phenylbutanoyl)amino]methyl-[4-[[(2S)-1-benzoylpyrrolidine-2-carbonyl]amino]butyl]phosphinic acid.
| Compound Name | [[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]-(4-phenylbutanoyl)amino]methyl-[4-[[(2S)-1-benzoylpyrrolidine-2-carbonyl]amino]butyl]phosphinic acid |
|---|---|
| PubChem CID | 70079857 |
| Molecular Formula | C39H51N4O6P |
| Molecular Weight | 702.83 g/mol |
| Exact Mass | 702.35 |
| IUPAC Name | [[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]-(4-phenylbutanoyl)amino]methyl-[4-[[(2S)-1-benzoylpyrrolidine-2-carbonyl]amino]butyl]phosphinic acid |
| SMILES | CC(C)C[C@@H](C(=O)Nc1ccccc1)N(CP(=O)(O)CCCCNC(=O)[C@@H]1CCCN1C(=O)c1ccccc1)C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C39H51N4O6P/c1-30(2)28-35(38(46)41-33-21-10-5-11-22-33)43(36(44)24-14-18-31-16-6-3-7-17-31)29-50(48,49)27-13-12-25-40-37(45)34-23-15-26-42(34)39(47)32-19-8-4-9-20-32/h3-11,16-17,19-22,30,34-35H,12-15,18,23-29H2,1-2H3,(H,40,45)(H,41,46)(H,48,49)/t34-,35-/m0/s1 |
| InChIKey | BOBVFMHBRNAZGT-PXLJZGITSA-N |
| XLogP | 6.32 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.83 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|