C14H16N2O3 — CID 70080135
tert-butyl 5-oxo-4-phenyl-1,2-dihydropyrazole-3-carboxylate (PubChem CID 70080135) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is tert-butyl 5-oxo-4-phenyl-1,2-dihydropyrazole-3-carboxylate.
| Compound Name | tert-butyl 5-oxo-4-phenyl-1,2-dihydropyrazole-3-carboxylate |
|---|---|
| PubChem CID | 70080135 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | tert-butyl 5-oxo-4-phenyl-1,2-dihydropyrazole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1[nH][nH]c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C14H16N2O3/c1-14(2,3)19-13(18)11-10(12(17)16-15-11)9-7-5-4-6-8-9/h4-8H,1-3H3,(H2,15,16,17) |
| InChIKey | NOYSTLPIEFCYFY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |