C14H13N3O2 — CID 70080549
N-(8-oxo-6,7-dihydro-5H-3,7-phenanthrolin-9-yl)acetamide (PubChem CID 70080549) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is N-(8-oxo-6,7-dihydro-5H-3,7-phenanthrolin-9-yl)acetamide.
| Compound Name | N-(8-oxo-6,7-dihydro-5H-3,7-phenanthrolin-9-yl)acetamide |
|---|---|
| PubChem CID | 70080549 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-(8-oxo-6,7-dihydro-5H-3,7-phenanthrolin-9-yl)acetamide |
| SMILES | CC(=O)Nc1cc2c([nH]c1=O)CCc1cnccc1-2 |
| InChI | InChI=1S/C14H13N3O2/c1-8(18)16-13-6-11-10-4-5-15-7-9(10)2-3-12(11)17-14(13)19/h4-7H,2-3H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | KEFTXSOSHDHOTP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |