C17H19NO4S — CID 70082556
4-[(3-phenoxyphenyl)methylsulfonyl]butanamide (PubChem CID 70082556) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-[(3-phenoxyphenyl)methylsulfonyl]butanamide.
| Compound Name | 4-[(3-phenoxyphenyl)methylsulfonyl]butanamide |
|---|---|
| PubChem CID | 70082556 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-[(3-phenoxyphenyl)methylsulfonyl]butanamide |
| SMILES | NC(=O)CCCS(=O)(=O)Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C17H19NO4S/c18-17(19)10-5-11-23(20,21)13-14-6-4-9-16(12-14)22-15-7-2-1-3-8-15/h1-4,6-9,12H,5,10-11,13H2,(H2,18,19) |
| InChIKey | VCCCSDIPPKPZOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |