About [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate
[butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate (PubChem CID 70086946) has the molecular formula C14H22O3Si
and a molecular weight of 266.41 g/mol. Its IUPAC name is [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate.
Molecular Properties
| Compound Name | [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate |
| PubChem CID | 70086946 |
| Molecular Formula | C14H22O3Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate |
| SMILES | CCCC[Si](C)(C)OC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H22O3Si/c1-4-5-11-18(2,3)17-14(16)13(15)12-9-7-6-8-10-12/h6-10,13,15H,4-5,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | XBXKIUCYPIBIDW-CYBMUJFWSA-N |
| XLogP | 3.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate?
The IUPAC name of [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate (CID 70086946) is [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate.
What is the SMILES notation for [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate?
The canonical SMILES for [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate is CCCC[Si](C)(C)OC(=O)[C@H](O)c1ccccc1.
What is the InChIKey of [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate?
The InChIKey is XBXKIUCYPIBIDW-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H22O3Si/c1-4-5-11-18(2,3)17-14(16)13(15)12-9-7-6-8-10-12/h6-10,13,15H,4-5,11H2,1-3H3/t13-/m1/s1.
What are the key properties of [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate?
[butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate has a molecular weight of 266.41 g/mol, XLogP of 3.27, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [butyl(dimethyl)silyl] (2R)-2-hydroxy-2-phenylacetate is sourced from PubChem (CID 70086946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).