C29H34N4O5 — CID 70088833
3-[[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]-propylamino]-3-phenylpropanoic acid (PubChem CID 70088833) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is 3-[[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]-propylamino]-3-phenylpropanoic acid.
| Compound Name | 3-[[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]-propylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70088833 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 3-[[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]-propylamino]-3-phenylpropanoic acid |
| SMILES | CCCN(NC(=O)Cc1ccc(NC(=O)Nc2ccccc2C)c(OC)c1)C(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O5/c1-4-16-33(25(19-28(35)36)22-11-6-5-7-12-22)32-27(34)18-21-14-15-24(26(17-21)38-3)31-29(37)30-23-13-9-8-10-20(23)2/h5-15,17,25H,4,16,18-19H2,1-3H3,(H,32,34)(H,35,36)(H2,30,31,37) |
| InChIKey | CZIQOAROMSRMKL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|