C25H33N5O6 — CID 70088943
3-[3-[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]propylcarbamoylamino]butanoic acid (PubChem CID 70088943) has the molecular formula C25H33N5O6 and a molecular weight of 499.57 g/mol. Its IUPAC name is 3-[3-[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]propylcarbamoylamino]butanoic acid.
| Compound Name | 3-[3-[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]propylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 70088943 |
| Molecular Formula | C25H33N5O6 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 3-[3-[[2-[3-methoxy-4-[(2-methylphenyl)carbamoylamino]phenyl]acetyl]amino]propylcarbamoylamino]butanoic acid |
| SMILES | COc1cc(CC(=O)NCCCNC(=O)NC(C)CC(=O)O)ccc1NC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C25H33N5O6/c1-16-7-4-5-8-19(16)29-25(35)30-20-10-9-18(14-21(20)36-3)15-22(31)26-11-6-12-27-24(34)28-17(2)13-23(32)33/h4-5,7-10,14,17H,6,11-13,15H2,1-3H3,(H,26,31)(H,32,33)(H2,27,28,34)(H2,29,30,35) |
| InChIKey | OSASRPMJBHCCDV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|