C28H31ClN4O6 — CID 70089076
5-O-[1-[2-(4-chlorophenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70089076) has the molecular formula C28H31ClN4O6 and a molecular weight of 555.03 g/mol. Its IUPAC name is 5-O-[1-[2-(4-chlorophenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[1-[2-(4-chlorophenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70089076 |
| Molecular Formula | C28H31ClN4O6 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 5-O-[1-[2-(4-chlorophenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)N2CCNCC2c2ccc(Cl)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H31ClN4O6/c1-16-24(27(34)38-4)26(20-6-5-7-22(14-20)33(36)37)25(17(2)31-16)28(35)39-18(3)32-13-12-30-15-23(32)19-8-10-21(29)11-9-19/h5-11,14,18,23,26,30-31H,12-13,15H2,1-4H3 |
| InChIKey | OJOICHFZCVKYRP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|