C22H21N3O5 — CID 70089194
but-2-enedioic acid;2-[(5-methyl-1H-imidazol-4-yl)methyl]-3,4-dihydrobenzo[h]isoquinolin-1-one (PubChem CID 70089194) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is but-2-enedioic acid;2-[(5-methyl-1H-imidazol-4-yl)methyl]-3,4-dihydrobenzo[h]isoquinolin-1-one.
| Compound Name | but-2-enedioic acid;2-[(5-methyl-1H-imidazol-4-yl)methyl]-3,4-dihydrobenzo[h]isoquinolin-1-one |
|---|---|
| PubChem CID | 70089194 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | but-2-enedioic acid;2-[(5-methyl-1H-imidazol-4-yl)methyl]-3,4-dihydrobenzo[h]isoquinolin-1-one |
| SMILES | Cc1[nH]cnc1CN1CCc2ccc3ccccc3c2C1=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H17N3O.C4H4O4/c1-12-16(20-11-19-12)10-21-9-8-14-7-6-13-4-2-3-5-15(13)17(14)18(21)22;5-3(6)1-2-4(7)8/h2-7,11H,8-10H2,1H3,(H,19,20);1-2H,(H,5,6)(H,7,8) |
| InChIKey | KTTNUOBYYVVJHH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|