C19H19N3O5 — CID 70055679
but-2-enedioic acid;1-(1H-indol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one (PubChem CID 70055679) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is but-2-enedioic acid;1-(1H-indol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one.
| Compound Name | but-2-enedioic acid;1-(1H-indol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 70055679 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | but-2-enedioic acid;1-(1H-indol-3-yl)-3-(5-methyl-1H-imidazol-4-yl)propan-1-one |
| SMILES | Cc1[nH]cnc1CCC(=O)c1c[nH]c2ccccc12.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H15N3O.C4H4O4/c1-10-13(18-9-17-10)6-7-15(19)12-8-16-14-5-3-2-4-11(12)14;5-3(6)1-2-4(7)8/h2-5,8-9,16H,6-7H2,1H3,(H,17,18);1-2H,(H,5,6)(H,7,8) |
| InChIKey | AJZRRMYEPMLFNN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 136.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|