C21H21N3O7 — CID 70040527
but-2-enedioic acid;methyl 3-[3-(5-methyl-1H-imidazol-4-yl)propanoyl]indole-1-carboxylate (PubChem CID 70040527) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is but-2-enedioic acid;methyl 3-[3-(5-methyl-1H-imidazol-4-yl)propanoyl]indole-1-carboxylate.
| Compound Name | but-2-enedioic acid;methyl 3-[3-(5-methyl-1H-imidazol-4-yl)propanoyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 70040527 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | but-2-enedioic acid;methyl 3-[3-(5-methyl-1H-imidazol-4-yl)propanoyl]indole-1-carboxylate |
| SMILES | COC(=O)n1cc(C(=O)CCc2nc[nH]c2C)c2ccccc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H17N3O3.C4H4O4/c1-11-14(19-10-18-11)7-8-16(21)13-9-20(17(22)23-2)15-6-4-3-5-12(13)15;5-3(6)1-2-4(7)8/h3-6,9-10H,7-8H2,1-2H3,(H,18,19);1-2H,(H,5,6)(H,7,8) |
| InChIKey | XHMRRZUMZMCHAC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|