C12H17N3O4 — CID 70090337
N-(6-amino-2-methoxy-3-nitrophenyl)-2,2-dimethylpropanamide (PubChem CID 70090337) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-(6-amino-2-methoxy-3-nitrophenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(6-amino-2-methoxy-3-nitrophenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 70090337 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-(6-amino-2-methoxy-3-nitrophenyl)-2,2-dimethylpropanamide |
| SMILES | COc1c([N+](=O)[O-])ccc(N)c1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H17N3O4/c1-12(2,3)11(16)14-9-7(13)5-6-8(15(17)18)10(9)19-4/h5-6H,13H2,1-4H3,(H,14,16) |
| InChIKey | XFUFGELMDKAVHS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|