C14H20N2O4 — CID 59675238
6-tert-butyl-2-methoxy-N,N-dimethyl-3-nitrobenzamide (PubChem CID 59675238) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 6-tert-butyl-2-methoxy-N,N-dimethyl-3-nitrobenzamide.
| Compound Name | 6-tert-butyl-2-methoxy-N,N-dimethyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 59675238 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 6-tert-butyl-2-methoxy-N,N-dimethyl-3-nitrobenzamide |
| SMILES | COc1c([N+](=O)[O-])ccc(C(C)(C)C)c1C(=O)N(C)C |
| InChI | InChI=1S/C14H20N2O4/c1-14(2,3)9-7-8-10(16(18)19)12(20-6)11(9)13(17)15(4)5/h7-8H,1-6H3 |
| InChIKey | FXADIHUDTBQGMI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|