C13H18N2O4 — CID 59675329
2-methoxy-N,N-dimethyl-3-nitro-6-propan-2-ylbenzamide (PubChem CID 59675329) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethyl-3-nitro-6-propan-2-ylbenzamide.
| Compound Name | 2-methoxy-N,N-dimethyl-3-nitro-6-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 59675329 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-methoxy-N,N-dimethyl-3-nitro-6-propan-2-ylbenzamide |
| SMILES | COc1c([N+](=O)[O-])ccc(C(C)C)c1C(=O)N(C)C |
| InChI | InChI=1S/C13H18N2O4/c1-8(2)9-6-7-10(15(17)18)12(19-5)11(9)13(16)14(3)4/h6-8H,1-5H3 |
| InChIKey | FJIBXKCXFYDIBK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|