C8H10N2O4S — CID 58736638
4-methoxy-N,N-dimethyl-5-nitrothiophene-3-carboxamide (PubChem CID 58736638) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-5-nitrothiophene-3-carboxamide.
| Compound Name | 4-methoxy-N,N-dimethyl-5-nitrothiophene-3-carboxamide |
|---|---|
| PubChem CID | 58736638 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-5-nitrothiophene-3-carboxamide |
| SMILES | COc1c(C(=O)N(C)C)csc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O4S/c1-9(2)7(11)5-4-15-8(10(12)13)6(5)14-3/h4H,1-3H3 |
| InChIKey | FUZCNJJFKLSALM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|