C24H31ClN6O4 — CID 70092028
N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-2-[(4-methanehydrazonoylphenyl)methylamino]acetamide;hydrochloride (PubChem CID 70092028) has the molecular formula C24H31ClN6O4 and a molecular weight of 503.00 g/mol. Its IUPAC name is N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-2-[(4-methanehydrazonoylphenyl)methylamino]acetamide;hydrochloride.
| Compound Name | N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-2-[(4-methanehydrazonoylphenyl)methylamino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 70092028 |
| Molecular Formula | C24H31ClN6O4 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | N-[2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-oxoethyl]-2-[(4-methanehydrazonoylphenyl)methylamino]acetamide;hydrochloride |
| SMILES | Cl.NN=Cc1ccc(CNCC(=O)NCC(=O)N2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C24H30N6O4.ClH/c25-28-13-19-3-1-18(2-4-19)12-26-14-23(31)27-15-24(32)30-9-7-29(8-10-30)16-20-5-6-21-22(11-20)34-17-33-21;/h1-6,11,13,26H,7-10,12,14-17,25H2,(H,27,31);1H |
| InChIKey | BNMWQBOPJKXXJA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|