C38H50N6O6 — CID 70092586
tert-butyl N-[(2S,3R,4S,5R)-5-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[1H-benzimidazol-2-ylmethyl(methyl)carbamoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 70092586) has the molecular formula C38H50N6O6 and a molecular weight of 686.85 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4S,5R)-5-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[1H-benzimidazol-2-ylmethyl(methyl)carbamoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4S,5R)-5-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[1H-benzimidazol-2-ylmethyl(methyl)carbamoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 70092586 |
| Molecular Formula | C38H50N6O6 |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.38 |
| IUPAC Name | tert-butyl N-[(2S,3R,4S,5R)-5-[[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-[1H-benzimidazol-2-ylmethyl(methyl)carbamoyl]amino]-3,4-dihydroxy-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](C(N)=O)N(C(=O)N(C)Cc1nc2ccccc2[nH]1)[C@H](Cc1ccccc1)[C@H](O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H50N6O6/c1-24(2)32(35(39)47)44(37(49)43(6)23-31-40-27-19-13-14-20-28(27)41-31)30(22-26-17-11-8-12-18-26)34(46)33(45)29(21-25-15-9-7-10-16-25)42-36(48)50-38(3,4)5/h7-20,24,29-30,32-34,45-46H,21-23H2,1-6H3,(H2,39,47)(H,40,41)(H,42,48)/t29-,30+,32-,33+,34-/m0/s1 |
| InChIKey | QEFGPRYTJAMSKR-LPRPMLJWSA-N |
| XLogP | 4.40 |
| TPSA | 174.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |