C19H20F3N3O5S — CID 70092789
N-[(3S)-3-amino-5,5,5-trifluoro-2-oxopentyl]-4-methyl-N-[(3-nitrophenyl)methyl]benzenesulfonamide (PubChem CID 70092789) has the molecular formula C19H20F3N3O5S and a molecular weight of 459.45 g/mol. Its IUPAC name is N-[(3S)-3-amino-5,5,5-trifluoro-2-oxopentyl]-4-methyl-N-[(3-nitrophenyl)methyl]benzenesulfonamide.
| Compound Name | N-[(3S)-3-amino-5,5,5-trifluoro-2-oxopentyl]-4-methyl-N-[(3-nitrophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70092789 |
| Molecular Formula | C19H20F3N3O5S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N-[(3S)-3-amino-5,5,5-trifluoro-2-oxopentyl]-4-methyl-N-[(3-nitrophenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)[C@@H](N)CC(F)(F)F)Cc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H20F3N3O5S/c1-13-5-7-16(8-6-13)31(29,30)24(12-18(26)17(23)10-19(20,21)22)11-14-3-2-4-15(9-14)25(27)28/h2-9,17H,10-12,23H2,1H3/t17-/m0/s1 |
| InChIKey | FYJHWKNWHJIETM-KRWDZBQOSA-N |
| XLogP | 2.94 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|