C21H21N5O6 — CID 70094371
2-[4-[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 70094371) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-[4-[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 70094371 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[4-[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)N(C(=O)OCc1ccccc1)c1ccc(C2(C)NC(=O)N(CC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C21H21N5O6/c1-21(17(29)25(11-16(27)28)19(30)24-21)14-7-9-15(10-8-14)26(18(22)23)20(31)32-12-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H3,22,23)(H,24,30)(H,27,28) |
| InChIKey | HJUABGLIKKHJFT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 166.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|