C31H26F3N3O4S — CID 70095251
N-[1-[4-(aminomethyl)phenyl]-2-(5-naphthalen-2-yl-3H-1,2-thiazol-2-yl)-2-oxoethyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 70095251) has the molecular formula C31H26F3N3O4S and a molecular weight of 593.63 g/mol. Its IUPAC name is N-[1-[4-(aminomethyl)phenyl]-2-(5-naphthalen-2-yl-3H-1,2-thiazol-2-yl)-2-oxoethyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[1-[4-(aminomethyl)phenyl]-2-(5-naphthalen-2-yl-3H-1,2-thiazol-2-yl)-2-oxoethyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70095251 |
| Molecular Formula | C31H26F3N3O4S |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | N-[1-[4-(aminomethyl)phenyl]-2-(5-naphthalen-2-yl-3H-1,2-thiazol-2-yl)-2-oxoethyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | NCc1ccc(C(NC(=O)c2ccccc2)C(=O)N2CC=C(c3ccc4ccccc4c3)S2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H25N3O2S.C2HF3O2/c30-19-20-10-12-22(13-11-20)27(31-28(33)23-7-2-1-3-8-23)29(34)32-17-16-26(35-32)25-15-14-21-6-4-5-9-24(21)18-25;3-2(4,5)1(6)7/h1-16,18,27H,17,19,30H2,(H,31,33);(H,6,7) |
| InChIKey | YHNGVYNPQGATRQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|