About 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one
5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one (PubChem CID 70096198) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one |
| PubChem CID | 70096198 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one |
| SMILES | C/C=C(\C)C1CC(=O)C=CC1(OC)OC |
| InChI | InChI=1S/C12H18O3/c1-5-9(2)11-8-10(13)6-7-12(11,14-3)15-4/h5-7,11H,8H2,1-4H3/b9-5+ |
| InChIKey | UPGNOMGQMXLISR-WEVVVXLNSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one?
The IUPAC name of 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one (CID 70096198) is 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one.
What is the SMILES notation for 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one?
The canonical SMILES for 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one is C/C=C(\C)C1CC(=O)C=CC1(OC)OC.
What is the InChIKey of 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one?
The InChIKey is UPGNOMGQMXLISR-WEVVVXLNSA-N. The full InChI is InChI=1S/C12H18O3/c1-5-9(2)11-8-10(13)6-7-12(11,14-3)15-4/h5-7,11H,8H2,1-4H3/b9-5+.
What are the key properties of 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one?
5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one has a molecular weight of 210.27 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-but-2-en-2-yl]-4,4-dimethoxycyclohex-2-en-1-one is sourced from PubChem (CID 70096198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).