C11H8F3NO3S — CID 70101920
3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 70101920) has the molecular formula C11H8F3NO3S and a molecular weight of 291.25 g/mol. Its IUPAC name is 3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 70101920 |
| Molecular Formula | C11H8F3NO3S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 3-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1CN(Cc2cccc(OC(F)(F)F)c2)C(=O)S1 |
| InChI | InChI=1S/C11H8F3NO3S/c12-11(13,14)18-8-3-1-2-7(4-8)5-15-6-9(16)19-10(15)17/h1-4H,5-6H2 |
| InChIKey | RPKSEDXTHZQIDO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|