C17H16BrF3N2O2 — CID 139940385
2-[(3-methoxyphenyl)methyl]-5-(trifluoromethoxy)-3H-isoindol-1-imine;hydrobromide (PubChem CID 139940385) has the molecular formula C17H16BrF3N2O2 and a molecular weight of 417.23 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl]-5-(trifluoromethoxy)-3H-isoindol-1-imine;hydrobromide.
| Compound Name | 2-[(3-methoxyphenyl)methyl]-5-(trifluoromethoxy)-3H-isoindol-1-imine;hydrobromide |
|---|---|
| PubChem CID | 139940385 |
| Molecular Formula | C17H16BrF3N2O2 |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl]-5-(trifluoromethoxy)-3H-isoindol-1-imine;hydrobromide |
| SMILES | Br.[H]/N=C1/c2ccc(OC(F)(F)F)cc2CN1Cc1cccc(OC)c1 |
| InChI | InChI=1S/C17H15F3N2O2.BrH/c1-23-13-4-2-3-11(7-13)9-22-10-12-8-14(24-17(18,19)20)5-6-15(12)16(22)21;/h2-8,21H,9-10H2,1H3;1H/b21-16-; |
| InChIKey | YREBWATZPFITKG-PLMZOXRSSA-N |
| XLogP | 4.51 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|