About 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate
6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate (PubChem CID 70102394) has the molecular formula C16H10Br2F2O3
and a molecular weight of 448.06 g/mol. Its IUPAC name is 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate.
Molecular Properties
| Compound Name | 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate |
| PubChem CID | 70102394 |
| Molecular Formula | C16H10Br2F2O3 |
| Molecular Weight | 448.06 g/mol |
| Exact Mass | 445.90 |
| IUPAC Name | 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate |
| SMILES | CC(=O)Oc1ccc(F)c(Br)c1.Fc1cc2ccoc2cc1Br |
| InChI | InChI=1S/C8H6BrFO2.C8H4BrFO/c1-5(11)12-6-2-3-8(10)7(9)4-6;9-6-4-8-5(1-2-11-8)3-7(6)10/h2-4H,1H3;1-4H |
| InChIKey | MAHWBCPQGRZKOQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.06 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate?
The IUPAC name of 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate (CID 70102394) is 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate.
What is the SMILES notation for 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate?
The canonical SMILES for 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate is CC(=O)Oc1ccc(F)c(Br)c1.Fc1cc2ccoc2cc1Br.
What is the InChIKey of 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate?
The InChIKey is MAHWBCPQGRZKOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrFO2.C8H4BrFO/c1-5(11)12-6-2-3-8(10)7(9)4-6;9-6-4-8-5(1-2-11-8)3-7(6)10/h2-4H,1H3;1-4H.
What are the key properties of 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate?
6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate has a molecular weight of 448.06 g/mol, XLogP of 5.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-fluoro-1-benzofuran;(3-bromo-4-fluorophenyl) acetate is sourced from PubChem (CID 70102394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).