C20H18N2O2 — CID 70103754
1,5-dibenzyl-1,3-diazepine-2-carboxylic acid (PubChem CID 70103754) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1,5-dibenzyl-1,3-diazepine-2-carboxylic acid.
| Compound Name | 1,5-dibenzyl-1,3-diazepine-2-carboxylic acid |
|---|---|
| PubChem CID | 70103754 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1,5-dibenzyl-1,3-diazepine-2-carboxylic acid |
| SMILES | O=C(O)C1=NC=C(Cc2ccccc2)C=CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N2O2/c23-20(24)19-21-14-18(13-16-7-3-1-4-8-16)11-12-22(19)15-17-9-5-2-6-10-17/h1-12,14H,13,15H2,(H,23,24) |
| InChIKey | QCMBFAFKKBNTNR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |