acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid

C16H18N2O5 — CID 70106532

IUPACacetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid
SMILESCC(=O)O.Nc1cccc(CCOc2ccc(C(=O)O)cc2)n1
InChIInChI=1S/C14H14N2O3.C2H4O2/c15-13-3-1-2-11(16-13)8-9-19-12-6-4-10(5-7-12)14(17)18;1-2(3)4/h1-7H,8-9H2,(H2,15,16)(H,17,18);1H3,(H,3,4)
InChIKeyXSRGILSUICHWEV-UHFFFAOYSA-N
MW318.33 g/mol
LogP2.07
Rot. Bonds5

About acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid

acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid (PubChem CID 70106532) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid.

Molecular Properties

Compound Nameacetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid
PubChem CID70106532
Molecular FormulaC16H18N2O5
Molecular Weight318.33 g/mol
Exact Mass318.12
IUPAC Nameacetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid
SMILESCC(=O)O.Nc1cccc(CCOc2ccc(C(=O)O)cc2)n1
InChIInChI=1S/C14H14N2O3.C2H4O2/c15-13-3-1-2-11(16-13)8-9-19-12-6-4-10(5-7-12)14(17)18;1-2(3)4/h1-7H,8-9H2,(H2,15,16)(H,17,18);1H3,(H,3,4)
InChIKeyXSRGILSUICHWEV-UHFFFAOYSA-N
XLogP2.07
TPSA122.74 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.33
LogP ≤ 52.07
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid?
The IUPAC name of acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid (CID 70106532) is acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid.
What is the SMILES notation for acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid?
The canonical SMILES for acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid is CC(=O)O.Nc1cccc(CCOc2ccc(C(=O)O)cc2)n1.
What is the InChIKey of acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid?
The InChIKey is XSRGILSUICHWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3.C2H4O2/c15-13-3-1-2-11(16-13)8-9-19-12-6-4-10(5-7-12)14(17)18;1-2(3)4/h1-7H,8-9H2,(H2,15,16)(H,17,18);1H3,(H,3,4).
What are the key properties of acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid?
acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid has a molecular weight of 318.33 g/mol, XLogP of 2.07, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-[2-(6-amino-2-pyridinyl)ethoxy]benzoic acid is sourced from PubChem (CID 70106532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).