C24H24N4O — CID 70107326
(2S,3S)-2-phenyl-N-[(5-pyrazin-2-yl-1-benzofuran-7-yl)methyl]piperidin-3-amine (PubChem CID 70107326) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-N-[(5-pyrazin-2-yl-1-benzofuran-7-yl)methyl]piperidin-3-amine.
| Compound Name | (2S,3S)-2-phenyl-N-[(5-pyrazin-2-yl-1-benzofuran-7-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 70107326 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2S,3S)-2-phenyl-N-[(5-pyrazin-2-yl-1-benzofuran-7-yl)methyl]piperidin-3-amine |
| SMILES | c1ccc([C@@H]2NCCC[C@@H]2NCc2cc(-c3cnccn3)cc3ccoc23)cc1 |
| InChI | InChI=1S/C24H24N4O/c1-2-5-17(6-3-1)23-21(7-4-9-27-23)28-15-20-14-19(22-16-25-10-11-26-22)13-18-8-12-29-24(18)20/h1-3,5-6,8,10-14,16,21,23,27-28H,4,7,9,15H2/t21-,23-/m0/s1 |
| InChIKey | UTHXIMZYLIUECV-GMAHTHKFSA-N |
| XLogP | 4.47 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |