C16H11ClN6O — CID 70108692
[6-chloro-3-(2H-tetrazol-5-ylmethyl)-1H-indol-2-yl]-pyridin-4-ylmethanone (PubChem CID 70108692) has the molecular formula C16H11ClN6O and a molecular weight of 338.76 g/mol. Its IUPAC name is [6-chloro-3-(2H-tetrazol-5-ylmethyl)-1H-indol-2-yl]-pyridin-4-ylmethanone.
| Compound Name | [6-chloro-3-(2H-tetrazol-5-ylmethyl)-1H-indol-2-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 70108692 |
| Molecular Formula | C16H11ClN6O |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | [6-chloro-3-(2H-tetrazol-5-ylmethyl)-1H-indol-2-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)c1[nH]c2cc(Cl)ccc2c1Cc1nn[nH]n1 |
| InChI | InChI=1S/C16H11ClN6O/c17-10-1-2-11-12(8-14-20-22-23-21-14)15(19-13(11)7-10)16(24)9-3-5-18-6-4-9/h1-7,19H,8H2,(H,20,21,22,23) |
| InChIKey | ZKCLTGUVIHYORY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|