C30H35N3O — CID 70108714
2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carbonitrile (PubChem CID 70108714) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is 2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carbonitrile.
| Compound Name | 2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carbonitrile |
|---|---|
| PubChem CID | 70108714 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carbonitrile |
| SMILES | CCn1c(CCC2CCCN2C(=O)C(c2ccccc2)C2CCCC2)cc2ccc(C#N)cc21 |
| InChI | InChI=1S/C30H35N3O/c1-2-32-27(20-25-15-14-22(21-31)19-28(25)32)17-16-26-13-8-18-33(26)30(34)29(24-11-6-7-12-24)23-9-4-3-5-10-23/h3-5,9-10,14-15,19-20,24,26,29H,2,6-8,11-13,16-18H2,1H3 |
| InChIKey | XEAUGFSUETVSMT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |