C30H38N4O — CID 21251575
2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide (PubChem CID 21251575) has the molecular formula C30H38N4O and a molecular weight of 470.66 g/mol. Its IUPAC name is 2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide.
| Compound Name | 2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide |
|---|---|
| PubChem CID | 21251575 |
| Molecular Formula | C30H38N4O |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 2-[2-[1-(2-cyclopentyl-2-phenylacetyl)pyrrolidin-2-yl]ethyl]-1-ethylindole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(CCC3CCCN3C(=O)C(c3ccccc3)C3CCCC3)n(CC)c2c1 |
| InChI | InChI=1S/C30H38N4O/c1-2-33-26(19-23-14-15-24(29(31)32)20-27(23)33)17-16-25-13-8-18-34(25)30(35)28(22-11-6-7-12-22)21-9-4-3-5-10-21/h3-5,9-10,14-15,19-20,22,25,28H,2,6-8,11-13,16-18H2,1H3,(H3,31,32) |
| InChIKey | XDNJNHRBFUVIQV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|